C11H23NO — CID 143378708
(2S)-2-ethyl-3,5-dimethylheptanamide (PubChem CID 143378708) has the molecular formula C11H23NO and a molecular weight of 185.31 g/mol. Its IUPAC name is (2S)-2-ethyl-3,5-dimethylheptanamide.
| Compound Name | (2S)-2-ethyl-3,5-dimethylheptanamide |
|---|---|
| PubChem CID | 143378708 |
| Molecular Formula | C11H23NO |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.18 |
| IUPAC Name | (2S)-2-ethyl-3,5-dimethylheptanamide |
| SMILES | CCC(C)CC(C)C(CC)C(N)=O |
| InChI | InChI=1S/C11H23NO/c1-5-8(3)7-9(4)10(6-2)11(12)13/h8-10H,5-7H2,1-4H3,(H2,12,13) |
| InChIKey | KCEIYTXGCAGJJA-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |