C7H16O5 — CID 87689978
carbonic acid;3-methylpentane-1,1-diol (PubChem CID 87689978) has the molecular formula C7H16O5 and a molecular weight of 180.20 g/mol. Its IUPAC name is carbonic acid;3-methylpentane-1,1-diol.
| Compound Name | carbonic acid;3-methylpentane-1,1-diol |
|---|---|
| PubChem CID | 87689978 |
| Molecular Formula | C7H16O5 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | carbonic acid;3-methylpentane-1,1-diol |
| SMILES | CCC(C)CC(O)O.O=C(O)O |
| InChI | InChI=1S/C6H14O2.CH2O3/c1-3-5(2)4-6(7)8;2-1(3)4/h5-8H,3-4H2,1-2H3;(H2,2,3,4) |
| InChIKey | QFGAHMKIMSDNJT-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|