C8H17NO2 — CID 123944975
N-hydroxy-2,4-dimethylhexanamide (PubChem CID 123944975) has the molecular formula C8H17NO2 and a molecular weight of 159.23 g/mol. Its IUPAC name is N-hydroxy-2,4-dimethylhexanamide.
| Compound Name | N-hydroxy-2,4-dimethylhexanamide |
|---|---|
| PubChem CID | 123944975 |
| Molecular Formula | C8H17NO2 |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.13 |
| IUPAC Name | N-hydroxy-2,4-dimethylhexanamide |
| SMILES | CCC(C)CC(C)C(=O)NO |
| InChI | InChI=1S/C8H17NO2/c1-4-6(2)5-7(3)8(10)9-11/h6-7,11H,4-5H2,1-3H3,(H,9,10) |
| InChIKey | OQPLMJZPPAWDPW-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|