C6H12N2O4 — CID 22809795
(2S)-2-amino-5-(hydroxyamino)-4-methyl-5-oxopentanoic acid (PubChem CID 22809795) has the molecular formula C6H12N2O4 and a molecular weight of 176.17 g/mol. Its IUPAC name is (2S)-2-amino-5-(hydroxyamino)-4-methyl-5-oxopentanoic acid.
| Compound Name | (2S)-2-amino-5-(hydroxyamino)-4-methyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 22809795 |
| Molecular Formula | C6H12N2O4 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | (2S)-2-amino-5-(hydroxyamino)-4-methyl-5-oxopentanoic acid |
| SMILES | CC(C[C@H](N)C(=O)O)C(=O)NO |
| InChI | InChI=1S/C6H12N2O4/c1-3(5(9)8-12)2-4(7)6(10)11/h3-4,12H,2,7H2,1H3,(H,8,9)(H,10,11)/t3?,4-/m0/s1 |
| InChIKey | QTXAXBWEQOBNEH-BKLSDQPFSA-N |
| XLogP | -1.07 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|