C18H23ClO6 — CID 62706789
dimethyl 2-[1-(4-chlorophenyl)-2-(2,2-dimethylpropanoyloxy)ethyl]propanedioate (PubChem CID 62706789) has the molecular formula C18H23ClO6 and a molecular weight of 370.83 g/mol. Its IUPAC name is dimethyl 2-[1-(4-chlorophenyl)-2-(2,2-dimethylpropanoyloxy)ethyl]propanedioate.
| Compound Name | dimethyl 2-[1-(4-chlorophenyl)-2-(2,2-dimethylpropanoyloxy)ethyl]propanedioate |
|---|---|
| PubChem CID | 62706789 |
| Molecular Formula | C18H23ClO6 |
| Molecular Weight | 370.83 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | dimethyl 2-[1-(4-chlorophenyl)-2-(2,2-dimethylpropanoyloxy)ethyl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)C(COC(=O)C(C)(C)C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H23ClO6/c1-18(2,3)17(22)25-10-13(11-6-8-12(19)9-7-11)14(15(20)23-4)16(21)24-5/h6-9,13-14H,10H2,1-5H3 |
| InChIKey | WDQCFRSHTHKDJX-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.83 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|