C15H23ClO3Si — CID 10335827
methyl (2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-(4-chlorophenyl)acetate (PubChem CID 10335827) has the molecular formula C15H23ClO3Si and a molecular weight of 314.89 g/mol. Its IUPAC name is methyl (2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-(4-chlorophenyl)acetate.
| Compound Name | methyl (2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-(4-chlorophenyl)acetate |
|---|---|
| PubChem CID | 10335827 |
| Molecular Formula | C15H23ClO3Si |
| Molecular Weight | 314.89 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | methyl (2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-(4-chlorophenyl)acetate |
| SMILES | COC(=O)[C@H](O[Si](C)(C)C(C)(C)C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H23ClO3Si/c1-15(2,3)20(5,6)19-13(14(17)18-4)11-7-9-12(16)10-8-11/h7-10,13H,1-6H3/t13-/m1/s1 |
| InChIKey | UXSLJDMUMFADMV-CYBMUJFWSA-N |
| XLogP | 4.58 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.89 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|