C15H18ClF3O3 — CID 155163030
methyl 2-(4-chlorophenyl)-4-hydroxy-3-methyl-3-(trifluoromethyl)hexanoate (PubChem CID 155163030) has the molecular formula C15H18ClF3O3 and a molecular weight of 338.75 g/mol. Its IUPAC name is methyl 2-(4-chlorophenyl)-4-hydroxy-3-methyl-3-(trifluoromethyl)hexanoate.
| Compound Name | methyl 2-(4-chlorophenyl)-4-hydroxy-3-methyl-3-(trifluoromethyl)hexanoate |
|---|---|
| PubChem CID | 155163030 |
| Molecular Formula | C15H18ClF3O3 |
| Molecular Weight | 338.75 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | methyl 2-(4-chlorophenyl)-4-hydroxy-3-methyl-3-(trifluoromethyl)hexanoate |
| SMILES | CCC(O)C(C)(C(C(=O)OC)c1ccc(Cl)cc1)C(F)(F)F |
| InChI | InChI=1S/C15H18ClF3O3/c1-4-11(20)14(2,15(17,18)19)12(13(21)22-3)9-5-7-10(16)8-6-9/h5-8,11-12,20H,4H2,1-3H3 |
| InChIKey | ZCQPQCAATSSGAV-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.75 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |