C15H18F3NO7S — CID 22865047
butoxycarbonyl (2S)-2-amino-3-[4-(trifluoromethylsulfonyloxy)phenyl]propanoate (PubChem CID 22865047) has the molecular formula C15H18F3NO7S and a molecular weight of 413.37 g/mol. Its IUPAC name is butoxycarbonyl (2S)-2-amino-3-[4-(trifluoromethylsulfonyloxy)phenyl]propanoate.
| Compound Name | butoxycarbonyl (2S)-2-amino-3-[4-(trifluoromethylsulfonyloxy)phenyl]propanoate |
|---|---|
| PubChem CID | 22865047 |
| Molecular Formula | C15H18F3NO7S |
| Molecular Weight | 413.37 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | butoxycarbonyl (2S)-2-amino-3-[4-(trifluoromethylsulfonyloxy)phenyl]propanoate |
| SMILES | CCCCOC(=O)OC(=O)[C@@H](N)Cc1ccc(OS(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H18F3NO7S/c1-2-3-8-24-14(21)25-13(20)12(19)9-10-4-6-11(7-5-10)26-27(22,23)15(16,17)18/h4-7,12H,2-3,8-9,19H2,1H3/t12-/m0/s1 |
| InChIKey | NKMLJNBTCHSFSH-LBPRGKRZSA-N |
| XLogP | 2.26 |
| TPSA | 121.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.37 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|