C10H11F3N2O4S — CID 175201724
[4-[(2S)-2,3-diamino-3-oxopropyl]phenyl] trifluoromethanesulfonate (PubChem CID 175201724) has the molecular formula C10H11F3N2O4S and a molecular weight of 312.27 g/mol. Its IUPAC name is [4-[(2S)-2,3-diamino-3-oxopropyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [4-[(2S)-2,3-diamino-3-oxopropyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 175201724 |
| Molecular Formula | C10H11F3N2O4S |
| Molecular Weight | 312.27 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | [4-[(2S)-2,3-diamino-3-oxopropyl]phenyl] trifluoromethanesulfonate |
| SMILES | NC(=O)[C@@H](N)Cc1ccc(OS(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H11F3N2O4S/c11-10(12,13)20(17,18)19-7-3-1-6(2-4-7)5-8(14)9(15)16/h1-4,8H,5,14H2,(H2,15,16)/t8-/m0/s1 |
| InChIKey | RNLMLNNEGNPTIM-QMMMGPOBSA-N |
| XLogP | 0.27 |
| TPSA | 112.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.27 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|