About [4-[(2S)-2,3-diamino-3-oxopropyl]phenyl] trifluoromethanesulfonate
[4-[(2S)-2,3-diamino-3-oxopropyl]phenyl] trifluoromethanesulfonate (PubChem CID 175201724) has the molecular formula C10H11F3N2O4S
and a molecular weight of 312.27 g/mol. Its IUPAC name is [4-[(2S)-2,3-diamino-3-oxopropyl]phenyl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [4-[(2S)-2,3-diamino-3-oxopropyl]phenyl] trifluoromethanesulfonate |
| PubChem CID | 175201724 |
| Molecular Formula | C10H11F3N2O4S |
| Molecular Weight | 312.27 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | [4-[(2S)-2,3-diamino-3-oxopropyl]phenyl] trifluoromethanesulfonate |
| SMILES | NC(=O)[C@@H](N)Cc1ccc(OS(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H11F3N2O4S/c11-10(12,13)20(17,18)19-7-3-1-6(2-4-7)5-8(14)9(15)16/h1-4,8H,5,14H2,(H2,15,16)/t8-/m0/s1 |
| InChIKey | RNLMLNNEGNPTIM-QMMMGPOBSA-N |
| XLogP | 0.27 |
| TPSA | 112.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.27 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [4-[(2S)-2,3-diamino-3-oxopropyl]phenyl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(2S)-2,3-diamino-3-oxopropyl]phenyl] trifluoromethanesulfonate?
The IUPAC name of [4-[(2S)-2,3-diamino-3-oxopropyl]phenyl] trifluoromethanesulfonate (CID 175201724) is [4-[(2S)-2,3-diamino-3-oxopropyl]phenyl] trifluoromethanesulfonate.
What is the SMILES notation for [4-[(2S)-2,3-diamino-3-oxopropyl]phenyl] trifluoromethanesulfonate?
The canonical SMILES for [4-[(2S)-2,3-diamino-3-oxopropyl]phenyl] trifluoromethanesulfonate is NC(=O)[C@@H](N)Cc1ccc(OS(=O)(=O)C(F)(F)F)cc1.
What is the InChIKey of [4-[(2S)-2,3-diamino-3-oxopropyl]phenyl] trifluoromethanesulfonate?
The InChIKey is RNLMLNNEGNPTIM-QMMMGPOBSA-N. The full InChI is InChI=1S/C10H11F3N2O4S/c11-10(12,13)20(17,18)19-7-3-1-6(2-4-7)5-8(14)9(15)16/h1-4,8H,5,14H2,(H2,15,16)/t8-/m0/s1.
What are the key properties of [4-[(2S)-2,3-diamino-3-oxopropyl]phenyl] trifluoromethanesulfonate?
[4-[(2S)-2,3-diamino-3-oxopropyl]phenyl] trifluoromethanesulfonate has a molecular weight of 312.27 g/mol, XLogP of 0.27, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(2S)-2,3-diamino-3-oxopropyl]phenyl] trifluoromethanesulfonate is sourced from PubChem (CID 175201724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).