C12H20N2O2Si — CID 167723544
(2S)-2-amino-3-(4-trimethylsilyloxyphenyl)propanamide (PubChem CID 167723544) has the molecular formula C12H20N2O2Si and a molecular weight of 252.39 g/mol. Its IUPAC name is (2S)-2-amino-3-(4-trimethylsilyloxyphenyl)propanamide.
| Compound Name | (2S)-2-amino-3-(4-trimethylsilyloxyphenyl)propanamide |
|---|---|
| PubChem CID | 167723544 |
| Molecular Formula | C12H20N2O2Si |
| Molecular Weight | 252.39 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | (2S)-2-amino-3-(4-trimethylsilyloxyphenyl)propanamide |
| SMILES | C[Si](C)(C)Oc1ccc(C[C@H](N)C(N)=O)cc1 |
| InChI | InChI=1S/C12H20N2O2Si/c1-17(2,3)16-10-6-4-9(5-7-10)8-11(13)12(14)15/h4-7,11H,8,13H2,1-3H3,(H2,14,15)/t11-/m0/s1 |
| InChIKey | KVLBEHGIHADGTP-NSHDSACASA-N |
| XLogP | 1.26 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.39 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|