C10H15N4O+ — CID 16740996
[amino-[4-[(2R)-2,3-diamino-3-oxopropyl]phenyl]methylidene]azanium (PubChem CID 16740996) has the molecular formula C10H15N4O+ and a molecular weight of 207.26 g/mol. Its IUPAC name is [amino-[4-[(2R)-2,3-diamino-3-oxopropyl]phenyl]methylidene]azanium.
| Compound Name | [amino-[4-[(2R)-2,3-diamino-3-oxopropyl]phenyl]methylidene]azanium |
|---|---|
| PubChem CID | 16740996 |
| Molecular Formula | C10H15N4O+ |
| Molecular Weight | 207.26 g/mol |
| Exact Mass | 207.12 |
| IUPAC Name | [amino-[4-[(2R)-2,3-diamino-3-oxopropyl]phenyl]methylidene]azanium |
| SMILES | NC(=[NH2+])c1ccc(C[C@@H](N)C(N)=O)cc1 |
| InChI | InChI=1S/C10H14N4O/c11-8(10(14)15)5-6-1-3-7(4-2-6)9(12)13/h1-4,8H,5,11H2,(H3,12,13)(H2,14,15)/p+1/t8-/m1/s1 |
| InChIKey | RIBOZFDUYGSFPW-MRVPVSSYSA-O |
| XLogP | -2.49 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.26 |
| LogP ≤ 5 | -2.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|