C26H21N5O2 — CID 122531253
3-phenyl-2-[9-(phenylmethoxymethyl)purin-6-yl]benzamide (PubChem CID 122531253) has the molecular formula C26H21N5O2 and a molecular weight of 435.49 g/mol. Its IUPAC name is 3-phenyl-2-[9-(phenylmethoxymethyl)purin-6-yl]benzamide.
| Compound Name | 3-phenyl-2-[9-(phenylmethoxymethyl)purin-6-yl]benzamide |
|---|---|
| PubChem CID | 122531253 |
| Molecular Formula | C26H21N5O2 |
| Molecular Weight | 435.49 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 3-phenyl-2-[9-(phenylmethoxymethyl)purin-6-yl]benzamide |
| SMILES | NC(=O)c1cccc(-c2ccccc2)c1-c1ncnc2c1ncn2COCc1ccccc1 |
| InChI | InChI=1S/C26H21N5O2/c27-25(32)21-13-7-12-20(19-10-5-2-6-11-19)22(21)23-24-26(29-15-28-23)31(16-30-24)17-33-14-18-8-3-1-4-9-18/h1-13,15-16H,14,17H2,(H2,27,32) |
| InChIKey | PBOQOCUOZIQILY-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.49 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |