C32H34N4 — CID 11248509
9-benzyl-6-(2,3,4,5-tetraethyl-6-phenylphenyl)purine (PubChem CID 11248509) has the molecular formula C32H34N4 and a molecular weight of 474.65 g/mol. Its IUPAC name is 9-benzyl-6-(2,3,4,5-tetraethyl-6-phenylphenyl)purine.
| Compound Name | 9-benzyl-6-(2,3,4,5-tetraethyl-6-phenylphenyl)purine |
|---|---|
| PubChem CID | 11248509 |
| Molecular Formula | C32H34N4 |
| Molecular Weight | 474.65 g/mol |
| Exact Mass | 474.28 |
| IUPAC Name | 9-benzyl-6-(2,3,4,5-tetraethyl-6-phenylphenyl)purine |
| SMILES | CCc1c(CC)c(CC)c(-c2ncnc3c2ncn3Cc2ccccc2)c(-c2ccccc2)c1CC |
| InChI | InChI=1S/C32H34N4/c1-5-24-25(6-2)27(8-4)29(28(26(24)7-3)23-17-13-10-14-18-23)30-31-32(34-20-33-30)36(21-35-31)19-22-15-11-9-12-16-22/h9-18,20-21H,5-8,19H2,1-4H3 |
| InChIKey | NNPINLGEXDYOCG-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.65 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |