C24H18N4 — CID 15499193
9-benzyl-2,6-diphenylpurine (PubChem CID 15499193) has the molecular formula C24H18N4 and a molecular weight of 362.44 g/mol. Its IUPAC name is 9-benzyl-2,6-diphenylpurine.
| Compound Name | 9-benzyl-2,6-diphenylpurine |
|---|---|
| PubChem CID | 15499193 |
| Molecular Formula | C24H18N4 |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 9-benzyl-2,6-diphenylpurine |
| SMILES | c1ccc(Cn2cnc3c(-c4ccccc4)nc(-c4ccccc4)nc32)cc1 |
| InChI | InChI=1S/C24H18N4/c1-4-10-18(11-5-1)16-28-17-25-22-21(19-12-6-2-7-13-19)26-23(27-24(22)28)20-14-8-3-9-15-20/h1-15,17H,16H2 |
| InChIKey | DZNRNZXJVCHYBE-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |