C20H22N6O2 — CID 57328253
9-benzyl-6-[4-(diethoxymethyl)-1H-pyrazol-5-yl]purine (PubChem CID 57328253) has the molecular formula C20H22N6O2 and a molecular weight of 378.44 g/mol. Its IUPAC name is 9-benzyl-6-[4-(diethoxymethyl)-1H-pyrazol-5-yl]purine.
| Compound Name | 9-benzyl-6-[4-(diethoxymethyl)-1H-pyrazol-5-yl]purine |
|---|---|
| PubChem CID | 57328253 |
| Molecular Formula | C20H22N6O2 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 9-benzyl-6-[4-(diethoxymethyl)-1H-pyrazol-5-yl]purine |
| SMILES | CCOC(OCC)c1cn[nH]c1-c1ncnc2c1ncn2Cc1ccccc1 |
| InChI | InChI=1S/C20H22N6O2/c1-3-27-20(28-4-2)15-10-24-25-16(15)17-18-19(22-12-21-17)26(13-23-18)11-14-8-6-5-7-9-14/h5-10,12-13,20H,3-4,11H2,1-2H3,(H,24,25) |
| InChIKey | VJDJOYPKZXYNOL-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 90.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|