C26H27N5O5 — CID 132534993
diethyl 2-[2-[(9-benzylpurin-6-yl)amino]-3-methoxyphenyl]propanedioate (PubChem CID 132534993) has the molecular formula C26H27N5O5 and a molecular weight of 489.53 g/mol. Its IUPAC name is diethyl 2-[2-[(9-benzylpurin-6-yl)amino]-3-methoxyphenyl]propanedioate.
| Compound Name | diethyl 2-[2-[(9-benzylpurin-6-yl)amino]-3-methoxyphenyl]propanedioate |
|---|---|
| PubChem CID | 132534993 |
| Molecular Formula | C26H27N5O5 |
| Molecular Weight | 489.53 g/mol |
| Exact Mass | 489.20 |
| IUPAC Name | diethyl 2-[2-[(9-benzylpurin-6-yl)amino]-3-methoxyphenyl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)c1cccc(OC)c1Nc1ncnc2c1ncn2Cc1ccccc1 |
| InChI | InChI=1S/C26H27N5O5/c1-4-35-25(32)20(26(33)36-5-2)18-12-9-13-19(34-3)21(18)30-23-22-24(28-15-27-23)31(16-29-22)14-17-10-7-6-8-11-17/h6-13,15-16,20H,4-5,14H2,1-3H3,(H,27,28,30) |
| InChIKey | VEEMKZDQMPFBQB-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 117.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.53 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|