C57H46N8O5 — CID 141478516
(1E,6E)-3,5-bis[4-(9-benzylpurin-6-yl)oxyphenyl]-1,7-bis(2-methoxyphenyl)hepta-1,6-dien-4-one (PubChem CID 141478516) has the molecular formula C57H46N8O5 and a molecular weight of 923.05 g/mol. Its IUPAC name is (1E,6E)-3,5-bis[4-(9-benzylpurin-6-yl)oxyphenyl]-1,7-bis(2-methoxyphenyl)hepta-1,6-dien-4-one.
| Compound Name | (1E,6E)-3,5-bis[4-(9-benzylpurin-6-yl)oxyphenyl]-1,7-bis(2-methoxyphenyl)hepta-1,6-dien-4-one |
|---|---|
| PubChem CID | 141478516 |
| Molecular Formula | C57H46N8O5 |
| Molecular Weight | 923.05 g/mol |
| Exact Mass | 922.36 |
| IUPAC Name | (1E,6E)-3,5-bis[4-(9-benzylpurin-6-yl)oxyphenyl]-1,7-bis(2-methoxyphenyl)hepta-1,6-dien-4-one |
| SMILES | COc1ccccc1/C=C/C(C(=O)C(/C=C/c1ccccc1OC)c1ccc(Oc2ncnc3c2ncn3Cc2ccccc2)cc1)c1ccc(Oc2ncnc3c2ncn3Cc2ccccc2)cc1 |
| InChI | InChI=1S/C57H46N8O5/c1-67-49-19-11-9-17-43(49)25-31-47(41-21-27-45(28-22-41)69-56-51-54(58-35-60-56)64(37-62-51)33-39-13-5-3-6-14-39)53(66)48(32-26-44-18-10-12-20-50(44)68-2)42-23-29-46(30-24-42)70-57-52-55(59-36-61-57)65(38-63-52)34-40-15-7-4-8-16-40/h3-32,35-38,47-48H,33-34H2,1-2H3/b31-25+,32-26+ |
| InChIKey | HFMHZHBJVJUAEM-YESHOFFLSA-N |
| XLogP | 11.53 |
| TPSA | 141.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 70 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 923.05 |
| LogP ≤ 5 | 11.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |