C16H17N5O2 — CID 172815770
ethyl 2-[6-(benzylamino)purin-9-yl]acetate (PubChem CID 172815770) has the molecular formula C16H17N5O2 and a molecular weight of 311.35 g/mol. Its IUPAC name is ethyl 2-[6-(benzylamino)purin-9-yl]acetate.
| Compound Name | ethyl 2-[6-(benzylamino)purin-9-yl]acetate |
|---|---|
| PubChem CID | 172815770 |
| Molecular Formula | C16H17N5O2 |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | ethyl 2-[6-(benzylamino)purin-9-yl]acetate |
| SMILES | CCOC(=O)Cn1cnc2c(NCc3ccccc3)ncnc21 |
| InChI | InChI=1S/C16H17N5O2/c1-2-23-13(22)9-21-11-20-14-15(18-10-19-16(14)21)17-8-12-6-4-3-5-7-12/h3-7,10-11H,2,8-9H2,1H3,(H,17,18,19) |
| InChIKey | SUCBWSUPZVNGFQ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |