C25H22N10 — CID 66780721
N-benzyl-9-[6-[(4-methylphenyl)methylamino]purin-9-yl]purin-6-amine (PubChem CID 66780721) has the molecular formula C25H22N10 and a molecular weight of 462.52 g/mol. Its IUPAC name is N-benzyl-9-[6-[(4-methylphenyl)methylamino]purin-9-yl]purin-6-amine.
| Compound Name | N-benzyl-9-[6-[(4-methylphenyl)methylamino]purin-9-yl]purin-6-amine |
|---|---|
| PubChem CID | 66780721 |
| Molecular Formula | C25H22N10 |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | N-benzyl-9-[6-[(4-methylphenyl)methylamino]purin-9-yl]purin-6-amine |
| SMILES | Cc1ccc(CNc2ncnc3c2ncn3-n2cnc3c(NCc4ccccc4)ncnc32)cc1 |
| InChI | InChI=1S/C25H22N10/c1-17-7-9-19(10-8-17)12-27-23-21-25(31-14-29-23)35(16-33-21)34-15-32-20-22(28-13-30-24(20)34)26-11-18-5-3-2-4-6-18/h2-10,13-16H,11-12H2,1H3,(H,26,28,30)(H,27,29,31) |
| InChIKey | QKUZSGVJVIMZPU-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 111.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |