C16H16N4O3 — CID 134850644
ethyl 2-[6-(4-methoxyphenyl)purin-9-yl]acetate (PubChem CID 134850644) has the molecular formula C16H16N4O3 and a molecular weight of 312.33 g/mol. Its IUPAC name is ethyl 2-[6-(4-methoxyphenyl)purin-9-yl]acetate.
| Compound Name | ethyl 2-[6-(4-methoxyphenyl)purin-9-yl]acetate |
|---|---|
| PubChem CID | 134850644 |
| Molecular Formula | C16H16N4O3 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | ethyl 2-[6-(4-methoxyphenyl)purin-9-yl]acetate |
| SMILES | CCOC(=O)Cn1cnc2c(-c3ccc(OC)cc3)ncnc21 |
| InChI | InChI=1S/C16H16N4O3/c1-3-23-13(21)8-20-10-19-15-14(17-9-18-16(15)20)11-4-6-12(22-2)7-5-11/h4-7,9-10H,3,8H2,1-2H3 |
| InChIKey | GLDJQMXJWYQKIS-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 79.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |