C21H22N4O5 — CID 3067842
ethyl 2-[[2-hydroxy-5,6-bis(4-methoxyphenyl)-1,2,4-triazin-3-ylidene]amino]acetate (PubChem CID 3067842) has the molecular formula C21H22N4O5 and a molecular weight of 410.43 g/mol. Its IUPAC name is ethyl 2-[[2-hydroxy-5,6-bis(4-methoxyphenyl)-1,2,4-triazin-3-ylidene]amino]acetate.
| Compound Name | ethyl 2-[[2-hydroxy-5,6-bis(4-methoxyphenyl)-1,2,4-triazin-3-ylidene]amino]acetate |
|---|---|
| PubChem CID | 3067842 |
| Molecular Formula | C21H22N4O5 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | ethyl 2-[[2-hydroxy-5,6-bis(4-methoxyphenyl)-1,2,4-triazin-3-ylidene]amino]acetate |
| SMILES | CCOC(=O)C/N=c1\nc(-c2ccc(OC)cc2)c(-c2ccc(OC)cc2)nn1O |
| InChI | InChI=1S/C21H22N4O5/c1-4-30-18(26)13-22-21-23-19(14-5-9-16(28-2)10-6-14)20(24-25(21)27)15-7-11-17(29-3)12-8-15/h5-12,27H,4,13H2,1-3H3/b22-21+ |
| InChIKey | AZIXAAPJVOJMLW-QURGRASLSA-N |
| XLogP | 2.33 |
| TPSA | 108.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|