C20H20N2O2 — CID 14100167
2,3-bis(4-methoxyphenyl)-5,6-dimethylpyrazine (PubChem CID 14100167) has the molecular formula C20H20N2O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is 2,3-bis(4-methoxyphenyl)-5,6-dimethylpyrazine.
| Compound Name | 2,3-bis(4-methoxyphenyl)-5,6-dimethylpyrazine |
|---|---|
| PubChem CID | 14100167 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 2,3-bis(4-methoxyphenyl)-5,6-dimethylpyrazine |
| SMILES | COc1ccc(-c2nc(C)c(C)nc2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C20H20N2O2/c1-13-14(2)22-20(16-7-11-18(24-4)12-8-16)19(21-13)15-5-9-17(23-3)10-6-15/h5-12H,1-4H3 |
| InChIKey | MIAZSPFHIGBMJJ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |