C14H16N2O — CID 169124555
3-(4-methoxyphenyl)-4,5,6-trimethylpyridazine (PubChem CID 169124555) has the molecular formula C14H16N2O and a molecular weight of 228.29 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-4,5,6-trimethylpyridazine.
| Compound Name | 3-(4-methoxyphenyl)-4,5,6-trimethylpyridazine |
|---|---|
| PubChem CID | 169124555 |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 3-(4-methoxyphenyl)-4,5,6-trimethylpyridazine |
| SMILES | COc1ccc(-c2nnc(C)c(C)c2C)cc1 |
| InChI | InChI=1S/C14H16N2O/c1-9-10(2)14(16-15-11(9)3)12-5-7-13(17-4)8-6-12/h5-8H,1-4H3 |
| InChIKey | ZUMDYBGAGOTANY-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |