C24H27N5O2 — CID 52522679
(2S)-1-[6-(benzylamino)purin-9-yl]-3-(2,3,6-trimethylphenoxy)propan-2-ol (PubChem CID 52522679) has the molecular formula C24H27N5O2 and a molecular weight of 417.51 g/mol. Its IUPAC name is (2S)-1-[6-(benzylamino)purin-9-yl]-3-(2,3,6-trimethylphenoxy)propan-2-ol.
| Compound Name | (2S)-1-[6-(benzylamino)purin-9-yl]-3-(2,3,6-trimethylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 52522679 |
| Molecular Formula | C24H27N5O2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | (2S)-1-[6-(benzylamino)purin-9-yl]-3-(2,3,6-trimethylphenoxy)propan-2-ol |
| SMILES | Cc1ccc(C)c(OC[C@@H](O)Cn2cnc3c(NCc4ccccc4)ncnc32)c1C |
| InChI | InChI=1S/C24H27N5O2/c1-16-9-10-17(2)22(18(16)3)31-13-20(30)12-29-15-28-21-23(26-14-27-24(21)29)25-11-19-7-5-4-6-8-19/h4-10,14-15,20,30H,11-13H2,1-3H3,(H,25,26,27)/t20-/m0/s1 |
| InChIKey | WYPBKRQMYPAQOS-FQEVSTJZSA-N |
| XLogP | 3.80 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |