C20H22N2O3 — CID 51283425
3-[2-hydroxy-3-(2,3,6-trimethylphenoxy)propyl]quinazolin-4-one (PubChem CID 51283425) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is 3-[2-hydroxy-3-(2,3,6-trimethylphenoxy)propyl]quinazolin-4-one.
| Compound Name | 3-[2-hydroxy-3-(2,3,6-trimethylphenoxy)propyl]quinazolin-4-one |
|---|---|
| PubChem CID | 51283425 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 3-[2-hydroxy-3-(2,3,6-trimethylphenoxy)propyl]quinazolin-4-one |
| SMILES | Cc1ccc(C)c(OCC(O)Cn2cnc3ccccc3c2=O)c1C |
| InChI | InChI=1S/C20H22N2O3/c1-13-8-9-14(2)19(15(13)3)25-11-16(23)10-22-12-21-18-7-5-4-6-17(18)20(22)24/h4-9,12,16,23H,10-11H2,1-3H3 |
| InChIKey | KYAGIDOBBGGZRS-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |