C19H19FN2O3 — CID 17403996
3-[3-(2,6-dimethylphenoxy)-2-hydroxypropyl]-7-fluoroquinazolin-4-one (PubChem CID 17403996) has the molecular formula C19H19FN2O3 and a molecular weight of 342.37 g/mol. Its IUPAC name is 3-[3-(2,6-dimethylphenoxy)-2-hydroxypropyl]-7-fluoroquinazolin-4-one.
| Compound Name | 3-[3-(2,6-dimethylphenoxy)-2-hydroxypropyl]-7-fluoroquinazolin-4-one |
|---|---|
| PubChem CID | 17403996 |
| Molecular Formula | C19H19FN2O3 |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 3-[3-(2,6-dimethylphenoxy)-2-hydroxypropyl]-7-fluoroquinazolin-4-one |
| SMILES | Cc1cccc(C)c1OCC(O)Cn1cnc2cc(F)ccc2c1=O |
| InChI | InChI=1S/C19H19FN2O3/c1-12-4-3-5-13(2)18(12)25-10-15(23)9-22-11-21-17-8-14(20)6-7-16(17)19(22)24/h3-8,11,15,23H,9-10H2,1-2H3 |
| InChIKey | MAYXAEGDTDWHGP-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |