C18H16FN3O2 — CID 40743513
N-(2,3-dimethylphenyl)-2-(7-fluoro-4-oxoquinazolin-3-yl)acetamide (PubChem CID 40743513) has the molecular formula C18H16FN3O2 and a molecular weight of 325.34 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-2-(7-fluoro-4-oxoquinazolin-3-yl)acetamide.
| Compound Name | N-(2,3-dimethylphenyl)-2-(7-fluoro-4-oxoquinazolin-3-yl)acetamide |
|---|---|
| PubChem CID | 40743513 |
| Molecular Formula | C18H16FN3O2 |
| Molecular Weight | 325.34 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | N-(2,3-dimethylphenyl)-2-(7-fluoro-4-oxoquinazolin-3-yl)acetamide |
| SMILES | Cc1cccc(NC(=O)Cn2cnc3cc(F)ccc3c2=O)c1C |
| InChI | InChI=1S/C18H16FN3O2/c1-11-4-3-5-15(12(11)2)21-17(23)9-22-10-20-16-8-13(19)6-7-14(16)18(22)24/h3-8,10H,9H2,1-2H3,(H,21,23) |
| InChIKey | SJWLZAWDSRZIIY-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.34 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |