C17H13FIN3O2 — CID 27075653
2-(7-fluoro-4-oxoquinazolin-3-yl)-N-(4-iodo-2-methylphenyl)acetamide (PubChem CID 27075653) has the molecular formula C17H13FIN3O2 and a molecular weight of 437.21 g/mol. Its IUPAC name is 2-(7-fluoro-4-oxoquinazolin-3-yl)-N-(4-iodo-2-methylphenyl)acetamide.
| Compound Name | 2-(7-fluoro-4-oxoquinazolin-3-yl)-N-(4-iodo-2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 27075653 |
| Molecular Formula | C17H13FIN3O2 |
| Molecular Weight | 437.21 g/mol |
| Exact Mass | 437.00 |
| IUPAC Name | 2-(7-fluoro-4-oxoquinazolin-3-yl)-N-(4-iodo-2-methylphenyl)acetamide |
| SMILES | Cc1cc(I)ccc1NC(=O)Cn1cnc2cc(F)ccc2c1=O |
| InChI | InChI=1S/C17H13FIN3O2/c1-10-6-12(19)3-5-14(10)21-16(23)8-22-9-20-15-7-11(18)2-4-13(15)17(22)24/h2-7,9H,8H2,1H3,(H,21,23) |
| InChIKey | QUTSQLCOQXVTBY-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.21 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|