C16H15FN2O4 — CID 51981456
7-fluoro-3-[(2S)-3-(furan-2-ylmethoxy)-2-hydroxypropyl]quinazolin-4-one (PubChem CID 51981456) has the molecular formula C16H15FN2O4 and a molecular weight of 318.30 g/mol. Its IUPAC name is 7-fluoro-3-[(2S)-3-(furan-2-ylmethoxy)-2-hydroxypropyl]quinazolin-4-one.
| Compound Name | 7-fluoro-3-[(2S)-3-(furan-2-ylmethoxy)-2-hydroxypropyl]quinazolin-4-one |
|---|---|
| PubChem CID | 51981456 |
| Molecular Formula | C16H15FN2O4 |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 7-fluoro-3-[(2S)-3-(furan-2-ylmethoxy)-2-hydroxypropyl]quinazolin-4-one |
| SMILES | O=c1c2ccc(F)cc2ncn1C[C@H](O)COCc1ccco1 |
| InChI | InChI=1S/C16H15FN2O4/c17-11-3-4-14-15(6-11)18-10-19(16(14)21)7-12(20)8-22-9-13-2-1-5-23-13/h1-6,10,12,20H,7-9H2/t12-/m0/s1 |
| InChIKey | KJOYJKHACDOUJC-LBPRGKRZSA-N |
| XLogP | 1.71 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |