C17H14F2N2O3 — CID 17465079
7-fluoro-3-[3-(4-fluorophenoxy)-2-hydroxypropyl]quinazolin-4-one (PubChem CID 17465079) has the molecular formula C17H14F2N2O3 and a molecular weight of 332.31 g/mol. Its IUPAC name is 7-fluoro-3-[3-(4-fluorophenoxy)-2-hydroxypropyl]quinazolin-4-one.
| Compound Name | 7-fluoro-3-[3-(4-fluorophenoxy)-2-hydroxypropyl]quinazolin-4-one |
|---|---|
| PubChem CID | 17465079 |
| Molecular Formula | C17H14F2N2O3 |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 7-fluoro-3-[3-(4-fluorophenoxy)-2-hydroxypropyl]quinazolin-4-one |
| SMILES | O=c1c2ccc(F)cc2ncn1CC(O)COc1ccc(F)cc1 |
| InChI | InChI=1S/C17H14F2N2O3/c18-11-1-4-14(5-2-11)24-9-13(22)8-21-10-20-16-7-12(19)3-6-15(16)17(21)23/h1-7,10,13,22H,8-9H2 |
| InChIKey | IFXODJNFXYREKT-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |