C12H20N5O6P — CID 11350247
[2-hydroxy-3-[6-(2-methoxyethylamino)purin-9-yl]propoxy]methylphosphonic acid (PubChem CID 11350247) has the molecular formula C12H20N5O6P and a molecular weight of 361.30 g/mol. Its IUPAC name is [2-hydroxy-3-[6-(2-methoxyethylamino)purin-9-yl]propoxy]methylphosphonic acid.
| Compound Name | [2-hydroxy-3-[6-(2-methoxyethylamino)purin-9-yl]propoxy]methylphosphonic acid |
|---|---|
| PubChem CID | 11350247 |
| Molecular Formula | C12H20N5O6P |
| Molecular Weight | 361.30 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | [2-hydroxy-3-[6-(2-methoxyethylamino)purin-9-yl]propoxy]methylphosphonic acid |
| SMILES | COCCNc1ncnc2c1ncn2CC(O)COCP(=O)(O)O |
| InChI | InChI=1S/C12H20N5O6P/c1-22-3-2-13-11-10-12(15-6-14-11)17(7-16-10)4-9(18)5-23-8-24(19,20)21/h6-7,9,18H,2-5,8H2,1H3,(H,13,14,15)(H2,19,20,21) |
| InChIKey | UTCPWGUGUUTUMN-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 151.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.30 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|