C16H27N6O5PS — CID 138554856
[(2R)-1-[6-[2-(5-sulfanylpentanoylamino)ethylamino]purin-9-yl]propan-2-yl]oxymethylphosphonic acid (PubChem CID 138554856) has the molecular formula C16H27N6O5PS and a molecular weight of 446.47 g/mol. Its IUPAC name is [(2R)-1-[6-[2-(5-sulfanylpentanoylamino)ethylamino]purin-9-yl]propan-2-yl]oxymethylphosphonic acid.
| Compound Name | [(2R)-1-[6-[2-(5-sulfanylpentanoylamino)ethylamino]purin-9-yl]propan-2-yl]oxymethylphosphonic acid |
|---|---|
| PubChem CID | 138554856 |
| Molecular Formula | C16H27N6O5PS |
| Molecular Weight | 446.47 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | [(2R)-1-[6-[2-(5-sulfanylpentanoylamino)ethylamino]purin-9-yl]propan-2-yl]oxymethylphosphonic acid |
| SMILES | C[C@H](Cn1cnc2c(NCCNC(=O)CCCCS)ncnc21)OCP(=O)(O)O |
| InChI | InChI=1S/C16H27N6O5PS/c1-12(27-11-28(24,25)26)8-22-10-21-14-15(19-9-20-16(14)22)18-6-5-17-13(23)4-2-3-7-29/h9-10,12,29H,2-8,11H2,1H3,(H,17,23)(H,18,19,20)(H2,24,25,26)/t12-/m1/s1 |
| InChIKey | WMVDPPBDOSCJHI-GFCCVEGCSA-N |
| XLogP | 0.99 |
| TPSA | 151.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.47 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|