C13H23N6O4P — CID 6320129
[(2S)-1-[6-[2-(dimethylamino)ethylamino]purin-9-yl]propan-2-yl]oxymethylphosphonic acid (PubChem CID 6320129) has the molecular formula C13H23N6O4P and a molecular weight of 358.34 g/mol. Its IUPAC name is [(2S)-1-[6-[2-(dimethylamino)ethylamino]purin-9-yl]propan-2-yl]oxymethylphosphonic acid.
| Compound Name | [(2S)-1-[6-[2-(dimethylamino)ethylamino]purin-9-yl]propan-2-yl]oxymethylphosphonic acid |
|---|---|
| PubChem CID | 6320129 |
| Molecular Formula | C13H23N6O4P |
| Molecular Weight | 358.34 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | [(2S)-1-[6-[2-(dimethylamino)ethylamino]purin-9-yl]propan-2-yl]oxymethylphosphonic acid |
| SMILES | C[C@@H](Cn1cnc2c(NCCN(C)C)ncnc21)OCP(=O)(O)O |
| InChI | InChI=1S/C13H23N6O4P/c1-10(23-9-24(20,21)22)6-19-8-17-11-12(14-4-5-18(2)3)15-7-16-13(11)19/h7-8,10H,4-6,9H2,1-3H3,(H,14,15,16)(H2,20,21,22)/t10-/m0/s1 |
| InChIKey | MSSNYTGVUZCIQC-JTQLQIEISA-N |
| XLogP | 0.34 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.34 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|