C11H16N5Na2O6P — CID 11165232
disodium;1-[6-(2-hydroxyethylamino)purin-9-yl]-3-(phosphonatomethoxy)propan-2-ol (PubChem CID 11165232) has the molecular formula C11H16N5Na2O6P and a molecular weight of 391.23 g/mol. Its IUPAC name is disodium;1-[6-(2-hydroxyethylamino)purin-9-yl]-3-(phosphonatomethoxy)propan-2-ol.
| Compound Name | disodium;1-[6-(2-hydroxyethylamino)purin-9-yl]-3-(phosphonatomethoxy)propan-2-ol |
|---|---|
| PubChem CID | 11165232 |
| Molecular Formula | C11H16N5Na2O6P |
| Molecular Weight | 391.23 g/mol |
| Exact Mass | 391.06 |
| IUPAC Name | disodium;1-[6-(2-hydroxyethylamino)purin-9-yl]-3-(phosphonatomethoxy)propan-2-ol |
| SMILES | O=P([O-])([O-])COCC(O)Cn1cnc2c(NCCO)ncnc21.[Na+].[Na+] |
| InChI | InChI=1S/C11H18N5O6P.2Na/c17-2-1-12-10-9-11(14-5-13-10)16(6-15-9)3-8(18)4-22-7-23(19,20)21;;/h5-6,8,17-18H,1-4,7H2,(H,12,13,14)(H2,19,20,21);;/q;2*+1/p-2 |
| InChIKey | LARISYKOIDESHR-UHFFFAOYSA-L |
| XLogP | -8.51 |
| TPSA | 168.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.23 |
| LogP ≤ 5 | -8.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|