C9H12N5Na2O5P — CID 164620739
disodium;(2R)-2-(6-aminopurin-9-yl)-3-(phosphonatomethoxy)propan-1-ol (PubChem CID 164620739) has the molecular formula C9H12N5Na2O5P and a molecular weight of 347.18 g/mol. Its IUPAC name is disodium;(2R)-2-(6-aminopurin-9-yl)-3-(phosphonatomethoxy)propan-1-ol.
| Compound Name | disodium;(2R)-2-(6-aminopurin-9-yl)-3-(phosphonatomethoxy)propan-1-ol |
|---|---|
| PubChem CID | 164620739 |
| Molecular Formula | C9H12N5Na2O5P |
| Molecular Weight | 347.18 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | disodium;(2R)-2-(6-aminopurin-9-yl)-3-(phosphonatomethoxy)propan-1-ol |
| SMILES | Nc1ncnc2c1ncn2[C@H](CO)COCP(=O)([O-])[O-].[Na+].[Na+] |
| InChI | InChI=1S/C9H14N5O5P.2Na/c10-8-7-9(12-3-11-8)14(4-13-7)6(1-15)2-19-5-20(16,17)18;;/h3-4,6,15H,1-2,5H2,(H2,10,11,12)(H2,16,17,18);;/q;2*+1/p-2/t6-;;/m1../s1 |
| InChIKey | NANVWYZYGCGFQJ-QYCVXMPOSA-L |
| XLogP | -8.16 |
| TPSA | 162.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.18 |
| LogP ≤ 5 | -8.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|