C13H22N5O5P — CID 11371805
[4-hydroxy-3-[6-(propan-2-ylamino)purin-9-yl]butoxy]methylphosphonic acid (PubChem CID 11371805) has the molecular formula C13H22N5O5P and a molecular weight of 359.32 g/mol. Its IUPAC name is [4-hydroxy-3-[6-(propan-2-ylamino)purin-9-yl]butoxy]methylphosphonic acid.
| Compound Name | [4-hydroxy-3-[6-(propan-2-ylamino)purin-9-yl]butoxy]methylphosphonic acid |
|---|---|
| PubChem CID | 11371805 |
| Molecular Formula | C13H22N5O5P |
| Molecular Weight | 359.32 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | [4-hydroxy-3-[6-(propan-2-ylamino)purin-9-yl]butoxy]methylphosphonic acid |
| SMILES | CC(C)Nc1ncnc2c1ncn2C(CO)CCOCP(=O)(O)O |
| InChI | InChI=1S/C13H22N5O5P/c1-9(2)17-12-11-13(15-6-14-12)18(7-16-11)10(5-19)3-4-23-8-24(20,21)22/h6-7,9-10,19H,3-5,8H2,1-2H3,(H,14,15,17)(H2,20,21,22) |
| InChIKey | RYRBHQSAWLMWDI-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 142.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.32 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|