C10H16N5O4P — CID 11460810
3-(6-aminopurin-7-yl)butoxymethylphosphonic acid (PubChem CID 11460810) has the molecular formula C10H16N5O4P and a molecular weight of 301.24 g/mol. Its IUPAC name is 3-(6-aminopurin-7-yl)butoxymethylphosphonic acid.
| Compound Name | 3-(6-aminopurin-7-yl)butoxymethylphosphonic acid |
|---|---|
| PubChem CID | 11460810 |
| Molecular Formula | C10H16N5O4P |
| Molecular Weight | 301.24 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 3-(6-aminopurin-7-yl)butoxymethylphosphonic acid |
| SMILES | CC(CCOCP(=O)(O)O)n1cnc2ncnc(N)c21 |
| InChI | InChI=1S/C10H16N5O4P/c1-7(2-3-19-6-20(16,17)18)15-5-14-10-8(15)9(11)12-4-13-10/h4-5,7H,2-3,6H2,1H3,(H2,11,12,13)(H2,16,17,18) |
| InChIKey | GCBYAGGPZZPAER-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 136.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.24 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|