C9H14N5O5P — CID 52914444
2-(6-amino-7-methyl-8-oxopurin-9-yl)ethoxymethylphosphonic acid (PubChem CID 52914444) has the molecular formula C9H14N5O5P and a molecular weight of 303.22 g/mol. Its IUPAC name is 2-(6-amino-7-methyl-8-oxopurin-9-yl)ethoxymethylphosphonic acid.
| Compound Name | 2-(6-amino-7-methyl-8-oxopurin-9-yl)ethoxymethylphosphonic acid |
|---|---|
| PubChem CID | 52914444 |
| Molecular Formula | C9H14N5O5P |
| Molecular Weight | 303.22 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 2-(6-amino-7-methyl-8-oxopurin-9-yl)ethoxymethylphosphonic acid |
| SMILES | Cn1c(=O)n(CCOCP(=O)(O)O)c2ncnc(N)c21 |
| InChI | InChI=1S/C9H14N5O5P/c1-13-6-7(10)11-4-12-8(6)14(9(13)15)2-3-19-5-20(16,17)18/h4H,2-3,5H2,1H3,(H2,10,11,12)(H2,16,17,18) |
| InChIKey | NAZUYTGXAOPQEY-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 145.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.22 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|