C8H12N5O4P — CID 513623
2-(4-aminopyrazolo[3,4-d]pyrimidin-1-yl)ethoxymethylphosphonic acid (PubChem CID 513623) has the molecular formula C8H12N5O4P and a molecular weight of 273.19 g/mol. Its IUPAC name is 2-(4-aminopyrazolo[3,4-d]pyrimidin-1-yl)ethoxymethylphosphonic acid.
| Compound Name | 2-(4-aminopyrazolo[3,4-d]pyrimidin-1-yl)ethoxymethylphosphonic acid |
|---|---|
| PubChem CID | 513623 |
| Molecular Formula | C8H12N5O4P |
| Molecular Weight | 273.19 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 2-(4-aminopyrazolo[3,4-d]pyrimidin-1-yl)ethoxymethylphosphonic acid |
| SMILES | Nc1ncnc2c1cnn2CCOCP(=O)(O)O |
| InChI | InChI=1S/C8H12N5O4P/c9-7-6-3-12-13(8(6)11-4-10-7)1-2-17-5-18(14,15)16/h3-4H,1-2,5H2,(H2,9,10,11)(H2,14,15,16) |
| InChIKey | LGLIUCJLXDTZJT-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 136.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.19 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|