C8H13N5 — CID 143264470
ethane;1-methylpyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 143264470) has the molecular formula C8H13N5 and a molecular weight of 179.23 g/mol. Its IUPAC name is ethane;1-methylpyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | ethane;1-methylpyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 143264470 |
| Molecular Formula | C8H13N5 |
| Molecular Weight | 179.23 g/mol |
| Exact Mass | 179.12 |
| IUPAC Name | ethane;1-methylpyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | CC.Cn1ncc2c(N)ncnc21 |
| InChI | InChI=1S/C6H7N5.C2H6/c1-11-6-4(2-10-11)5(7)8-3-9-6;1-2/h2-3H,1H3,(H2,7,8,9);1-2H3 |
| InChIKey | ZMFQEWXNJNYTRJ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.23 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |