C10H13ClN4 — CID 63203147
4-(3-chlorobutan-2-yl)-1-methylpyrazolo[3,4-d]pyrimidine (PubChem CID 63203147) has the molecular formula C10H13ClN4 and a molecular weight of 224.69 g/mol. Its IUPAC name is 4-(3-chlorobutan-2-yl)-1-methylpyrazolo[3,4-d]pyrimidine.
| Compound Name | 4-(3-chlorobutan-2-yl)-1-methylpyrazolo[3,4-d]pyrimidine |
|---|---|
| PubChem CID | 63203147 |
| Molecular Formula | C10H13ClN4 |
| Molecular Weight | 224.69 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 4-(3-chlorobutan-2-yl)-1-methylpyrazolo[3,4-d]pyrimidine |
| SMILES | CC(Cl)C(C)c1ncnc2c1cnn2C |
| InChI | InChI=1S/C10H13ClN4/c1-6(7(2)11)9-8-4-14-15(3)10(8)13-5-12-9/h4-7H,1-3H3 |
| InChIKey | BRNYORQHGFUJIE-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.69 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|