C10H16N5O6P — CID 57180182
[4-(6-aminopurin-9-yl)oxy-4-hydroxybutoxy]methylphosphonic acid (PubChem CID 57180182) has the molecular formula C10H16N5O6P and a molecular weight of 333.24 g/mol. Its IUPAC name is [4-(6-aminopurin-9-yl)oxy-4-hydroxybutoxy]methylphosphonic acid.
| Compound Name | [4-(6-aminopurin-9-yl)oxy-4-hydroxybutoxy]methylphosphonic acid |
|---|---|
| PubChem CID | 57180182 |
| Molecular Formula | C10H16N5O6P |
| Molecular Weight | 333.24 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | [4-(6-aminopurin-9-yl)oxy-4-hydroxybutoxy]methylphosphonic acid |
| SMILES | Nc1ncnc2c1ncn2OC(O)CCCOCP(=O)(O)O |
| InChI | InChI=1S/C10H16N5O6P/c11-9-8-10(13-4-12-9)15(5-14-8)21-7(16)2-1-3-20-6-22(17,18)19/h4-5,7,16H,1-3,6H2,(H2,11,12,13)(H2,17,18,19) |
| InChIKey | IGPZNCXJHQOICZ-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 165.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.24 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|