C20H38N5O6PSi — CID 19993546
9-[1-[tert-butyl(dimethyl)silyl]oxy-4-(diethoxyphosphorylmethoxy)butan-2-yl]oxypurin-6-amine (PubChem CID 19993546) has the molecular formula C20H38N5O6PSi and a molecular weight of 503.61 g/mol. Its IUPAC name is 9-[1-[tert-butyl(dimethyl)silyl]oxy-4-(diethoxyphosphorylmethoxy)butan-2-yl]oxypurin-6-amine.
| Compound Name | 9-[1-[tert-butyl(dimethyl)silyl]oxy-4-(diethoxyphosphorylmethoxy)butan-2-yl]oxypurin-6-amine |
|---|---|
| PubChem CID | 19993546 |
| Molecular Formula | C20H38N5O6PSi |
| Molecular Weight | 503.61 g/mol |
| Exact Mass | 503.23 |
| IUPAC Name | 9-[1-[tert-butyl(dimethyl)silyl]oxy-4-(diethoxyphosphorylmethoxy)butan-2-yl]oxypurin-6-amine |
| SMILES | CCOP(=O)(COCCC(CO[Si](C)(C)C(C)(C)C)On1cnc2c(N)ncnc21)OCC |
| InChI | InChI=1S/C20H38N5O6PSi/c1-8-28-32(26,29-9-2)15-27-11-10-16(12-30-33(6,7)20(3,4)5)31-25-14-24-17-18(21)22-13-23-19(17)25/h13-14,16H,8-12,15H2,1-7H3,(H2,21,22,23) |
| InChIKey | CTGPZPSKWRPFLH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 132.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.61 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|