C20H35ClN5O7PSi — CID 57098052
N-[9-[1-[tert-butyl(dimethyl)silyl]oxy-3-(diethoxyphosphorylmethoxy)propoxy]-6-chloropurin-2-yl]formamide (PubChem CID 57098052) has the molecular formula C20H35ClN5O7PSi and a molecular weight of 552.04 g/mol. Its IUPAC name is N-[9-[1-[tert-butyl(dimethyl)silyl]oxy-3-(diethoxyphosphorylmethoxy)propoxy]-6-chloropurin-2-yl]formamide.
| Compound Name | N-[9-[1-[tert-butyl(dimethyl)silyl]oxy-3-(diethoxyphosphorylmethoxy)propoxy]-6-chloropurin-2-yl]formamide |
|---|---|
| PubChem CID | 57098052 |
| Molecular Formula | C20H35ClN5O7PSi |
| Molecular Weight | 552.04 g/mol |
| Exact Mass | 551.17 |
| IUPAC Name | N-[9-[1-[tert-butyl(dimethyl)silyl]oxy-3-(diethoxyphosphorylmethoxy)propoxy]-6-chloropurin-2-yl]formamide |
| SMILES | CCOP(=O)(COCCC(On1cnc2c(Cl)nc(NC=O)nc21)O[Si](C)(C)C(C)(C)C)OCC |
| InChI | InChI=1S/C20H35ClN5O7PSi/c1-8-30-34(28,31-9-2)14-29-11-10-15(33-35(6,7)20(3,4)5)32-26-12-22-16-17(21)24-19(23-13-27)25-18(16)26/h12-13,15H,8-11,14H2,1-7H3,(H,23,24,25,27) |
| InChIKey | QNJCLXRIIUPAKE-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.04 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|