C22H38Cl2N4O2Si2 — CID 11734039
tert-butyl-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(2,6-dichloropurin-9-yl)but-2-enoxy]-dimethylsilane (PubChem CID 11734039) has the molecular formula C22H38Cl2N4O2Si2 and a molecular weight of 517.65 g/mol. Its IUPAC name is tert-butyl-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(2,6-dichloropurin-9-yl)but-2-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(2,6-dichloropurin-9-yl)but-2-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11734039 |
| Molecular Formula | C22H38Cl2N4O2Si2 |
| Molecular Weight | 517.65 g/mol |
| Exact Mass | 516.19 |
| IUPAC Name | tert-butyl-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(2,6-dichloropurin-9-yl)but-2-enoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCC(=CCn1cnc2c(Cl)nc(Cl)nc21)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H38Cl2N4O2Si2/c1-21(2,3)31(7,8)29-13-16(14-30-32(9,10)22(4,5)6)11-12-28-15-25-17-18(23)26-20(24)27-19(17)28/h11,15H,12-14H2,1-10H3 |
| InChIKey | SFPVMQOZBNVXIJ-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.65 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|