C12H14Cl2N4 — CID 18440611
2,6-dichloro-9-[(E)-hept-4-enyl]purine (PubChem CID 18440611) has the molecular formula C12H14Cl2N4 and a molecular weight of 285.18 g/mol. Its IUPAC name is 2,6-dichloro-9-[(E)-hept-4-enyl]purine.
| Compound Name | 2,6-dichloro-9-[(E)-hept-4-enyl]purine |
|---|---|
| PubChem CID | 18440611 |
| Molecular Formula | C12H14Cl2N4 |
| Molecular Weight | 285.18 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 2,6-dichloro-9-[(E)-hept-4-enyl]purine |
| SMILES | CC/C=C/CCCn1cnc2c(Cl)nc(Cl)nc21 |
| InChI | InChI=1S/C12H14Cl2N4/c1-2-3-4-5-6-7-18-8-15-9-10(13)16-12(14)17-11(9)18/h3-4,8H,2,5-7H2,1H3/b4-3+ |
| InChIKey | JJKSNLKXVLTYTQ-ONEGZZNKSA-N |
| XLogP | 3.88 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.18 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|