ethyl 7-(2,6-dichloropurin-9-yl)heptanoate

C14H18Cl2N4O2 — CID 118366979

IUPACethyl 7-(2,6-dichloropurin-9-yl)heptanoate
SMILESCCOC(=O)CCCCCCn1cnc2c(Cl)nc(Cl)nc21
InChIInChI=1S/C14H18Cl2N4O2/c1-2-22-10(21)7-5-3-4-6-8-20-9-17-11-12(15)18-14(16)19-13(11)20/h9H,2-8H2,1H3
InChIKeyUIMQTRBQOBSYPN-UHFFFAOYSA-N
MW345.23 g/mol
LogP3.65
Rot. Bonds8

About ethyl 7-(2,6-dichloropurin-9-yl)heptanoate

ethyl 7-(2,6-dichloropurin-9-yl)heptanoate (PubChem CID 118366979) has the molecular formula C14H18Cl2N4O2 and a molecular weight of 345.23 g/mol. Its IUPAC name is ethyl 7-(2,6-dichloropurin-9-yl)heptanoate.

Molecular Properties

Compound Nameethyl 7-(2,6-dichloropurin-9-yl)heptanoate
PubChem CID118366979
Molecular FormulaC14H18Cl2N4O2
Molecular Weight345.23 g/mol
Exact Mass344.08
IUPAC Nameethyl 7-(2,6-dichloropurin-9-yl)heptanoate
SMILESCCOC(=O)CCCCCCn1cnc2c(Cl)nc(Cl)nc21
InChIInChI=1S/C14H18Cl2N4O2/c1-2-22-10(21)7-5-3-4-6-8-20-9-17-11-12(15)18-14(16)19-13(11)20/h9H,2-8H2,1H3
InChIKeyUIMQTRBQOBSYPN-UHFFFAOYSA-N
XLogP3.65
TPSA69.90 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds8
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500345.23
LogP ≤ 53.65
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze ethyl 7-(2,6-dichloropurin-9-yl)heptanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 7-(2,6-dichloropurin-9-yl)heptanoate?
The IUPAC name of ethyl 7-(2,6-dichloropurin-9-yl)heptanoate (CID 118366979) is ethyl 7-(2,6-dichloropurin-9-yl)heptanoate.
What is the SMILES notation for ethyl 7-(2,6-dichloropurin-9-yl)heptanoate?
The canonical SMILES for ethyl 7-(2,6-dichloropurin-9-yl)heptanoate is CCOC(=O)CCCCCCn1cnc2c(Cl)nc(Cl)nc21.
What is the InChIKey of ethyl 7-(2,6-dichloropurin-9-yl)heptanoate?
The InChIKey is UIMQTRBQOBSYPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18Cl2N4O2/c1-2-22-10(21)7-5-3-4-6-8-20-9-17-11-12(15)18-14(16)19-13(11)20/h9H,2-8H2,1H3.
What are the key properties of ethyl 7-(2,6-dichloropurin-9-yl)heptanoate?
ethyl 7-(2,6-dichloropurin-9-yl)heptanoate has a molecular weight of 345.23 g/mol, XLogP of 3.65, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 7-(2,6-dichloropurin-9-yl)heptanoate is sourced from PubChem (CID 118366979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).