C14H18Cl2N4O2 — CID 118366979
ethyl 7-(2,6-dichloropurin-9-yl)heptanoate (PubChem CID 118366979) has the molecular formula C14H18Cl2N4O2 and a molecular weight of 345.23 g/mol. Its IUPAC name is ethyl 7-(2,6-dichloropurin-9-yl)heptanoate.
| Compound Name | ethyl 7-(2,6-dichloropurin-9-yl)heptanoate |
|---|---|
| PubChem CID | 118366979 |
| Molecular Formula | C14H18Cl2N4O2 |
| Molecular Weight | 345.23 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | ethyl 7-(2,6-dichloropurin-9-yl)heptanoate |
| SMILES | CCOC(=O)CCCCCCn1cnc2c(Cl)nc(Cl)nc21 |
| InChI | InChI=1S/C14H18Cl2N4O2/c1-2-22-10(21)7-5-3-4-6-8-20-9-17-11-12(15)18-14(16)19-13(11)20/h9H,2-8H2,1H3 |
| InChIKey | UIMQTRBQOBSYPN-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.23 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|