C14H20N4O3S — CID 155185476
ethyl 5-(1,3-dimethyl-2-oxo-6-sulfanylidenepurin-7-yl)pentanoate (PubChem CID 155185476) has the molecular formula C14H20N4O3S and a molecular weight of 324.41 g/mol. Its IUPAC name is ethyl 5-(1,3-dimethyl-2-oxo-6-sulfanylidenepurin-7-yl)pentanoate.
| Compound Name | ethyl 5-(1,3-dimethyl-2-oxo-6-sulfanylidenepurin-7-yl)pentanoate |
|---|---|
| PubChem CID | 155185476 |
| Molecular Formula | C14H20N4O3S |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | ethyl 5-(1,3-dimethyl-2-oxo-6-sulfanylidenepurin-7-yl)pentanoate |
| SMILES | CCOC(=O)CCCCn1cnc2c1c(=S)n(C)c(=O)n2C |
| InChI | InChI=1S/C14H20N4O3S/c1-4-21-10(19)7-5-6-8-18-9-15-12-11(18)13(22)17(3)14(20)16(12)2/h9H,4-8H2,1-3H3 |
| InChIKey | LYRMGLVLKXFOLK-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 71.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|