C12H16N4O2S — CID 164804702
1,3-dimethyl-7-(4-oxopentyl)-6-sulfanylidenepurin-2-one (PubChem CID 164804702) has the molecular formula C12H16N4O2S and a molecular weight of 280.35 g/mol. Its IUPAC name is 1,3-dimethyl-7-(4-oxopentyl)-6-sulfanylidenepurin-2-one.
| Compound Name | 1,3-dimethyl-7-(4-oxopentyl)-6-sulfanylidenepurin-2-one |
|---|---|
| PubChem CID | 164804702 |
| Molecular Formula | C12H16N4O2S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 1,3-dimethyl-7-(4-oxopentyl)-6-sulfanylidenepurin-2-one |
| SMILES | CC(=O)CCCn1cnc2c1c(=S)n(C)c(=O)n2C |
| InChI | InChI=1S/C12H16N4O2S/c1-8(17)5-4-6-16-7-13-10-9(16)11(19)15(3)12(18)14(10)2/h7H,4-6H2,1-3H3 |
| InChIKey | KDKKNRJQFSFVNY-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|