C12H14N4O2S — CID 155185551
7-(2-cyclopropyl-2-oxoethyl)-1,3-dimethyl-6-sulfanylidenepurin-2-one (PubChem CID 155185551) has the molecular formula C12H14N4O2S and a molecular weight of 278.34 g/mol. Its IUPAC name is 7-(2-cyclopropyl-2-oxoethyl)-1,3-dimethyl-6-sulfanylidenepurin-2-one.
| Compound Name | 7-(2-cyclopropyl-2-oxoethyl)-1,3-dimethyl-6-sulfanylidenepurin-2-one |
|---|---|
| PubChem CID | 155185551 |
| Molecular Formula | C12H14N4O2S |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 7-(2-cyclopropyl-2-oxoethyl)-1,3-dimethyl-6-sulfanylidenepurin-2-one |
| SMILES | Cn1c(=S)c2c(ncn2CC(=O)C2CC2)n(C)c1=O |
| InChI | InChI=1S/C12H14N4O2S/c1-14-10-9(11(19)15(2)12(14)18)16(6-13-10)5-8(17)7-3-4-7/h6-7H,3-5H2,1-2H3 |
| InChIKey | HVYFLBDWSCXCJE-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|